C28H25N2O2Pt- — CID 139253832
N,N-diphenyl-4-pyridin-2-ylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;platinum (PubChem CID 139253832) has the molecular formula C28H25N2O2Pt- and a molecular weight of 616.60 g/mol. Its IUPAC name is N,N-diphenyl-4-pyridin-2-ylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;platinum.
| Compound Name | N,N-diphenyl-4-pyridin-2-ylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;platinum |
|---|---|
| PubChem CID | 139253832 |
| Molecular Formula | C28H25N2O2Pt- |
| Molecular Weight | 616.60 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | N,N-diphenyl-4-pyridin-2-ylbenzene-5-id-1-amine;(Z)-4-hydroxypent-3-en-2-one;platinum |
| SMILES | CC(=O)/C=C(/C)O.[Pt].[c-]1cc(N(c2ccccc2)c2ccccc2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C23H17N2.C5H8O2.Pt/c1-3-9-20(10-4-1)25(21-11-5-2-6-12-21)22-16-14-19(15-17-22)23-13-7-8-18-24-23;1-4(6)3-5(2)7;/h1-14,16-18H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | KUMVRIJEZHYIDQ-LWFKIUJUSA-N |
| XLogP | 7.05 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|