C28H29F3N4O2 — CID 139254168
3-amino-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 139254168) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is 3-amino-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 3-amino-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 139254168 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 3-amino-4-(3-but-3-enyl-6,6-dimethyl-4-oxo-5,7-dihydroindazol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | C=CCCc1nn(-c2ccc(C(=O)NCc3cccc(C(F)(F)F)c3)cc2N)c2c1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C28H29F3N4O2/c1-4-5-9-21-25-23(14-27(2,3)15-24(25)36)35(34-21)22-11-10-18(13-20(22)32)26(37)33-16-17-7-6-8-19(12-17)28(29,30)31/h4,6-8,10-13H,1,5,9,14-16,32H2,2-3H3,(H,33,37) |
| InChIKey | QBVCSPIOGKUXQR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|