C14H28O2Si — CID 139254513
8,8-dimethyl-1-trimethylsilylnonane-3,5-dione (PubChem CID 139254513) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 8,8-dimethyl-1-trimethylsilylnonane-3,5-dione.
| Compound Name | 8,8-dimethyl-1-trimethylsilylnonane-3,5-dione |
|---|---|
| PubChem CID | 139254513 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 8,8-dimethyl-1-trimethylsilylnonane-3,5-dione |
| SMILES | CC(C)(C)CCC(=O)CC(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-14(2,3)9-7-12(15)11-13(16)8-10-17(4,5)6/h7-11H2,1-6H3 |
| InChIKey | OEQUBKGNLZGOSC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|