C31H35NO3Si — CID 139254693
3-[(E)-2-cyclohexyl-1-triphenylsilyloxyethenyl]-4,4-dimethyl-1,3-oxazolidin-2-one (PubChem CID 139254693) has the molecular formula C31H35NO3Si and a molecular weight of 497.71 g/mol. Its IUPAC name is 3-[(E)-2-cyclohexyl-1-triphenylsilyloxyethenyl]-4,4-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[(E)-2-cyclohexyl-1-triphenylsilyloxyethenyl]-4,4-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139254693 |
| Molecular Formula | C31H35NO3Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 3-[(E)-2-cyclohexyl-1-triphenylsilyloxyethenyl]-4,4-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)COC(=O)N1/C(=C\C1CCCCC1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H35NO3Si/c1-31(2)24-34-30(33)32(31)29(23-25-15-7-3-8-16-25)35-36(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h4-6,9-14,17-23,25H,3,7-8,15-16,24H2,1-2H3/b29-23+ |
| InChIKey | QMYPHVYFIUYHBQ-BYNJWEBRSA-N |
| XLogP | 5.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|