C33H33GeNO2Zn — CID 164684506
zinc;4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane (PubChem CID 164684506) has the molecular formula C33H33GeNO2Zn and a molecular weight of 613.63 g/mol. Its IUPAC name is zinc;4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane.
| Compound Name | zinc;4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane |
|---|---|
| PubChem CID | 164684506 |
| Molecular Formula | C33H33GeNO2Zn |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.10 |
| IUPAC Name | zinc;4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one;ethane |
| SMILES | CC1(C)COC(=O)N1/[C-]=C(/c1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C31H28GeNO2.C2H5.Zn/c1-31(2)24-35-30(34)33(31)23-29(25-15-7-3-8-16-25)32(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28;1-2;/h3-22H,24H2,1-2H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | GICWDMGVSRGPGO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|