C34H33GeNO2 — CID 164684503
4,4-dimethyl-3-[(1E)-1-phenyl-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one (PubChem CID 164684503) has the molecular formula C34H33GeNO2 and a molecular weight of 560.25 g/mol. Its IUPAC name is 4,4-dimethyl-3-[(1E)-1-phenyl-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | 4,4-dimethyl-3-[(1E)-1-phenyl-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164684503 |
| Molecular Formula | C34H33GeNO2 |
| Molecular Weight | 560.25 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 4,4-dimethyl-3-[(1E)-1-phenyl-1-triphenylgermylpenta-1,4-dien-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CC/C(=C(/c1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1)N1C(=O)OCC1(C)C |
| InChI | InChI=1S/C34H33GeNO2/c1-4-17-31(36-33(37)38-26-34(36,2)3)32(27-18-9-5-10-19-27)35(28-20-11-6-12-21-28,29-22-13-7-14-23-29)30-24-15-8-16-25-30/h4-16,18-25H,1,17,26H2,2-3H3/b32-31+ |
| InChIKey | GHAOEDCXKUYMOY-QNEJGDQOSA-N |
| XLogP | 5.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.25 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|