C31H29GeNO2 — CID 164684507
4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one (PubChem CID 164684507) has the molecular formula C31H29GeNO2 and a molecular weight of 520.19 g/mol. Its IUPAC name is 4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 164684507 |
| Molecular Formula | C31H29GeNO2 |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 521.14 |
| IUPAC Name | 4,4-dimethyl-3-(2-phenyl-2-triphenylgermylethenyl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C)COC(=O)N1C=C(c1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H29GeNO2/c1-31(2)24-35-30(34)33(31)23-29(25-15-7-3-8-16-25)32(26-17-9-4-10-18-26,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-23H,24H2,1-2H3 |
| InChIKey | YTUSNXQNUNFGGA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |