C62H66N4O2 — CID 139255397
[4-[10,20-bis(3,5-ditert-butylphenyl)-15-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanol (PubChem CID 139255397) has the molecular formula C62H66N4O2 and a molecular weight of 899.24 g/mol. Its IUPAC name is [4-[10,20-bis(3,5-ditert-butylphenyl)-15-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanol.
| Compound Name | [4-[10,20-bis(3,5-ditert-butylphenyl)-15-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanol |
|---|---|
| PubChem CID | 139255397 |
| Molecular Formula | C62H66N4O2 |
| Molecular Weight | 899.24 g/mol |
| Exact Mass | 898.52 |
| IUPAC Name | [4-[10,20-bis(3,5-ditert-butylphenyl)-15-[4-(hydroxymethyl)phenyl]-21,23-dihydroporphyrin-5-yl]phenyl]methanol |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4ccc(CO)cc4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(CO)cc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C62H66N4O2/c1-59(2,3)43-29-41(30-44(33-43)60(4,5)6)57-51-25-21-47(63-51)55(39-17-13-37(35-67)14-18-39)49-23-27-53(65-49)58(42-31-45(61(7,8)9)34-46(32-42)62(10,11)12)54-28-24-50(66-54)56(48-22-26-52(57)64-48)40-19-15-38(36-68)16-20-40/h13-34,63,66-68H,35-36H2,1-12H3/b55-47-,55-49-,56-48-,56-50-,57-51-,57-52-,58-53-,58-54- |
| InChIKey | IOYHXILJJWNUOK-UJNHEQPASA-N |
| XLogP | 15.50 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.24 |
| LogP ≤ 5 | 15.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |