C18H30O2Si — CID 139255883
(2E,5R,7E,10E)-8,10-dimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal (PubChem CID 139255883) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (2E,5R,7E,10E)-8,10-dimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal.
| Compound Name | (2E,5R,7E,10E)-8,10-dimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal |
|---|---|
| PubChem CID | 139255883 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (2E,5R,7E,10E)-8,10-dimethyl-5-trimethylsilyloxytrideca-2,7,10,12-tetraenal |
| SMILES | C=C/C=C(\C)C/C(C)=C/C[C@@H](C/C=C/C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-7-10-16(2)15-17(3)12-13-18(11-8-9-14-19)20-21(4,5)6/h7-10,12,14,18H,1,11,13,15H2,2-6H3/b9-8+,16-10+,17-12+/t18-/m1/s1 |
| InChIKey | OHDLVVRBEFZBSB-VNKQXBCKSA-N |
| XLogP | 5.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|