C20H34O4Si — CID 139256624
ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 139256624) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
| Compound Name | ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 139256624 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | ethyl (1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | CCOC(=O)C1=C(O[Si](C)(C)C(C)(C)C)C[C@]2(C(C)C)C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C20H34O4Si/c1-10-22-17(21)16-15(23-25(8,9)18(4,5)6)13-20(14(2)3)12-11-19(16,7)24-20/h11-12,14H,10,13H2,1-9H3/t19-,20+/m1/s1 |
| InChIKey | GGFSPZTYCJBHMY-UXHICEINSA-N |
| XLogP | 4.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|