About zinc;ethane;methylsulfanylbenzene
zinc;ethane;methylsulfanylbenzene (PubChem CID 139256875) has the molecular formula C9H12SZn
and a molecular weight of 217.65 g/mol. Its IUPAC name is zinc;ethane;methylsulfanylbenzene.
Molecular Properties
| Compound Name | zinc;ethane;methylsulfanylbenzene |
| PubChem CID | 139256875 |
| Molecular Formula | C9H12SZn |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | zinc;ethane;methylsulfanylbenzene |
| SMILES | CSc1cc[c-]cc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C7H7S.C2H5.Zn/c1-8-7-5-3-2-4-6-7;1-2;/h3-6H,1H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | YLGMZODAACBIRA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;ethane;methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;ethane;methylsulfanylbenzene?
The IUPAC name of zinc;ethane;methylsulfanylbenzene (CID 139256875) is zinc;ethane;methylsulfanylbenzene.
What is the SMILES notation for zinc;ethane;methylsulfanylbenzene?
The canonical SMILES for zinc;ethane;methylsulfanylbenzene is CSc1cc[c-]cc1.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;ethane;methylsulfanylbenzene?
The InChIKey is YLGMZODAACBIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7S.C2H5.Zn/c1-8-7-5-3-2-4-6-7;1-2;/h3-6H,1H3;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;ethane;methylsulfanylbenzene?
zinc;ethane;methylsulfanylbenzene has a molecular weight of 217.65 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;ethane;methylsulfanylbenzene is sourced from PubChem (CID 139256875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).