C14H14S — CID 101416374
(3E,5E,7Z)-7-methylsulfanyltrideca-1,3,5,7-tetraen-9,11-diyne (PubChem CID 101416374) has the molecular formula C14H14S and a molecular weight of 214.33 g/mol. Its IUPAC name is (3E,5E,7Z)-7-methylsulfanyltrideca-1,3,5,7-tetraen-9,11-diyne.
| Compound Name | (3E,5E,7Z)-7-methylsulfanyltrideca-1,3,5,7-tetraen-9,11-diyne |
|---|---|
| PubChem CID | 101416374 |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (3E,5E,7Z)-7-methylsulfanyltrideca-1,3,5,7-tetraen-9,11-diyne |
| SMILES | C=C/C=C/C=C/C(=C/C#CC#CC)SC |
| InChI | InChI=1S/C14H14S/c1-4-6-8-10-12-14(15-3)13-11-9-7-5-2/h4,6,8,10,12-13H,1H2,2-3H3/b8-6+,12-10+,14-13- |
| InChIKey | LABBLCKGUPHUSZ-HJQNFIAGSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|