C14H10S — CID 162874038
8-methylsulfanyltrideca-1,7-dien-3,5,9,11-tetrayne (PubChem CID 162874038) has the molecular formula C14H10S and a molecular weight of 210.30 g/mol. Its IUPAC name is 8-methylsulfanyltrideca-1,7-dien-3,5,9,11-tetrayne.
| Compound Name | 8-methylsulfanyltrideca-1,7-dien-3,5,9,11-tetrayne |
|---|---|
| PubChem CID | 162874038 |
| Molecular Formula | C14H10S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 8-methylsulfanyltrideca-1,7-dien-3,5,9,11-tetrayne |
| SMILES | C=CC#CC#CC=C(C#CC#CC)SC |
| InChI | InChI=1S/C14H10S/c1-4-6-8-9-11-13-14(15-3)12-10-7-5-2/h4,13H,1H2,2-3H3 |
| InChIKey | UXKZYARBTQKFQT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|