C11H7ClI2O2 — CID 139257536
5-(4-chlorophenyl)-3,4-diiodo-5-methylfuran-2-one (PubChem CID 139257536) has the molecular formula C11H7ClI2O2 and a molecular weight of 460.44 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,4-diiodo-5-methylfuran-2-one.
| Compound Name | 5-(4-chlorophenyl)-3,4-diiodo-5-methylfuran-2-one |
|---|---|
| PubChem CID | 139257536 |
| Molecular Formula | C11H7ClI2O2 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 459.82 |
| IUPAC Name | 5-(4-chlorophenyl)-3,4-diiodo-5-methylfuran-2-one |
| SMILES | CC1(c2ccc(Cl)cc2)OC(=O)C(I)=C1I |
| InChI | InChI=1S/C11H7ClI2O2/c1-11(6-2-4-7(12)5-3-6)9(14)8(13)10(15)16-11/h2-5H,1H3 |
| InChIKey | KKRPVZQEYNYMDT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|