C45H57N3O12 — CID 139257778
methyl 3-[6-[3,5-bis[6-[(2-methoxycarbonyl-3-pyridinyl)oxy]hexoxy]phenoxy]hexoxy]pyridine-2-carboxylate (PubChem CID 139257778) has the molecular formula C45H57N3O12 and a molecular weight of 831.96 g/mol. Its IUPAC name is methyl 3-[6-[3,5-bis[6-[(2-methoxycarbonyl-3-pyridinyl)oxy]hexoxy]phenoxy]hexoxy]pyridine-2-carboxylate.
| Compound Name | methyl 3-[6-[3,5-bis[6-[(2-methoxycarbonyl-3-pyridinyl)oxy]hexoxy]phenoxy]hexoxy]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 139257778 |
| Molecular Formula | C45H57N3O12 |
| Molecular Weight | 831.96 g/mol |
| Exact Mass | 831.39 |
| IUPAC Name | methyl 3-[6-[3,5-bis[6-[(2-methoxycarbonyl-3-pyridinyl)oxy]hexoxy]phenoxy]hexoxy]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncccc1OCCCCCCOc1cc(OCCCCCCOc2cccnc2C(=O)OC)cc(OCCCCCCOc2cccnc2C(=O)OC)c1 |
| InChI | InChI=1S/C45H57N3O12/c1-52-43(49)40-37(19-16-22-46-40)58-28-13-7-4-10-25-55-34-31-35(56-26-11-5-8-14-29-59-38-20-17-23-47-41(38)44(50)53-2)33-36(32-34)57-27-12-6-9-15-30-60-39-21-18-24-48-42(39)45(51)54-3/h16-24,31-33H,4-15,25-30H2,1-3H3 |
| InChIKey | GIASQCOTXLDXNG-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 172.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.96 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|