C54H92N2S2Sn2 — CID 139257781
[9,18-di(heptadecan-9-yl)-15-trimethylstannyl-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]-trimethylstannane (PubChem CID 139257781) has the molecular formula C54H92N2S2Sn2 and a molecular weight of 1070.90 g/mol. Its IUPAC name is [9,18-di(heptadecan-9-yl)-15-trimethylstannyl-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]-trimethylstannane.
| Compound Name | [9,18-di(heptadecan-9-yl)-15-trimethylstannyl-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]-trimethylstannane |
|---|---|
| PubChem CID | 139257781 |
| Molecular Formula | C54H92N2S2Sn2 |
| Molecular Weight | 1070.90 g/mol |
| Exact Mass | 1072.47 |
| IUPAC Name | [9,18-di(heptadecan-9-yl)-15-trimethylstannyl-5,14-dithia-9,18-diazapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1(12),2,4(8),6,10,13(17),15-heptaen-6-yl]-trimethylstannane |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc3c4sc([Sn](C)(C)C)cc4n(C(CCCCCCCC)CCCCCCCC)c3cc2c2sc([Sn](C)(C)C)cc21 |
| InChI | InChI=1S/C48H74N2S2.6CH3.2Sn/c1-5-9-13-17-21-25-29-39(30-26-22-18-14-10-6-2)49-43-33-35-51-47(43)41-38-46-42(37-45(41)49)48-44(34-36-52-48)50(46)40(31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;;;;;;;;/h33-34,37-40H,5-32H2,1-4H3;6*1H3;; |
| InChIKey | VRYFGGCWSVAFIJ-UHFFFAOYSA-N |
| XLogP | 19.20 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.90 |
| LogP ≤ 5 | 19.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|