About methyl N-sulfonylcarbamate;oxolane
methyl N-sulfonylcarbamate;oxolane (PubChem CID 139258006) has the molecular formula C6H11NO5S
and a molecular weight of 209.22 g/mol. Its IUPAC name is methyl N-sulfonylcarbamate;oxolane.
Molecular Properties
| Compound Name | methyl N-sulfonylcarbamate;oxolane |
| PubChem CID | 139258006 |
| Molecular Formula | C6H11NO5S |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | methyl N-sulfonylcarbamate;oxolane |
| SMILES | C1CCOC1.COC(=O)N=S(=O)=O |
| InChI | InChI=1S/C4H8O.C2H3NO4S/c1-2-4-5-3-1;1-7-2(4)3-8(5)6/h1-4H2;1H3 |
| InChIKey | UNCKZMZAQHKEKW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-sulfonylcarbamate;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-sulfonylcarbamate;oxolane?
The IUPAC name of methyl N-sulfonylcarbamate;oxolane (CID 139258006) is methyl N-sulfonylcarbamate;oxolane.
What is the SMILES notation for methyl N-sulfonylcarbamate;oxolane?
The canonical SMILES for methyl N-sulfonylcarbamate;oxolane is C1CCOC1.COC(=O)N=S(=O)=O.
What is the InChIKey of methyl N-sulfonylcarbamate;oxolane?
The InChIKey is UNCKZMZAQHKEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2H3NO4S/c1-2-4-5-3-1;1-7-2(4)3-8(5)6/h1-4H2;1H3.
What are the key properties of methyl N-sulfonylcarbamate;oxolane?
methyl N-sulfonylcarbamate;oxolane has a molecular weight of 209.22 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-sulfonylcarbamate;oxolane is sourced from PubChem (CID 139258006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).