C32H26BF5N2O6S2 — CID 139258903
difluoro-[5-[(1E)-2,2,2-trifluoro-1-[2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-5-ylidene]ethyl]-2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-4-yl]borane (PubChem CID 139258903) has the molecular formula C32H26BF5N2O6S2 and a molecular weight of 704.50 g/mol. Its IUPAC name is difluoro-[5-[(1E)-2,2,2-trifluoro-1-[2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-5-ylidene]ethyl]-2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-4-yl]borane.
| Compound Name | difluoro-[5-[(1E)-2,2,2-trifluoro-1-[2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-5-ylidene]ethyl]-2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-4-yl]borane |
|---|---|
| PubChem CID | 139258903 |
| Molecular Formula | C32H26BF5N2O6S2 |
| Molecular Weight | 704.50 g/mol |
| Exact Mass | 704.12 |
| IUPAC Name | difluoro-[5-[(1E)-2,2,2-trifluoro-1-[2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-5-ylidene]ethyl]-2-(3,4,5-trimethoxyphenyl)thieno[3,2-b]pyrrol-4-yl]borane |
| SMILES | COc1cc(-c2cc3c(s2)=C/C(=C(/c2cc4sc(-c5cc(OC)c(OC)c(OC)c5)cc4n2B(F)F)C(F)(F)F)N=3)cc(OC)c1OC |
| InChI | InChI=1S/C32H26BF5N2O6S2/c1-41-21-7-15(8-22(42-2)30(21)45-5)25-11-17-27(47-25)12-18(39-17)29(32(34,35)36)20-14-28-19(40(20)33(37)38)13-26(48-28)16-9-23(43-3)31(46-6)24(10-16)44-4/h7-14H,1-6H3/b29-18+ |
| InChIKey | IHIASLNOTGKFRT-RDRPBHBLSA-N |
| XLogP | 7.31 |
| TPSA | 72.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.50 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|