C34H30N2O4 — CID 139259322
(3R)-3-[(3S)-1,3-dibenzyl-2-oxoindol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 139259322) has the molecular formula C34H30N2O4 and a molecular weight of 530.62 g/mol. Its IUPAC name is (3R)-3-[(3S)-1,3-dibenzyl-2-oxoindol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(3S)-1,3-dibenzyl-2-oxoindol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259322 |
| Molecular Formula | C34H30N2O4 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (3R)-3-[(3S)-1,3-dibenzyl-2-oxoindol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccccc1CN1C(=O)C[C@H]([C@]2(Cc3ccccc3)C(=O)N(Cc3ccccc3)c3ccccc32)C1=O |
| InChI | InChI=1S/C34H30N2O4/c1-40-30-19-11-8-16-26(30)23-36-31(37)20-28(32(36)38)34(21-24-12-4-2-5-13-24)27-17-9-10-18-29(27)35(33(34)39)22-25-14-6-3-7-15-25/h2-19,28H,20-23H2,1H3/t28-,34+/m0/s1 |
| InChIKey | ZWGFRAZYWPZBPM-IPZQJPLYSA-N |
| XLogP | 5.30 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|