C32H25FN2O3 — CID 139259395
(3R)-3-[(3S)-1,3-dibenzyl-7-fluoro-2-oxoindol-3-yl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 139259395) has the molecular formula C32H25FN2O3 and a molecular weight of 504.56 g/mol. Its IUPAC name is (3R)-3-[(3S)-1,3-dibenzyl-7-fluoro-2-oxoindol-3-yl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(3S)-1,3-dibenzyl-7-fluoro-2-oxoindol-3-yl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259395 |
| Molecular Formula | C32H25FN2O3 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (3R)-3-[(3S)-1,3-dibenzyl-7-fluoro-2-oxoindol-3-yl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([C@]2(Cc3ccccc3)C(=O)N(Cc3ccccc3)c3c(F)cccc32)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C32H25FN2O3/c33-27-18-10-17-25-29(27)34(21-23-13-6-2-7-14-23)31(38)32(25,20-22-11-4-1-5-12-22)26-19-28(36)35(30(26)37)24-15-8-3-9-16-24/h1-18,26H,19-21H2/t26-,32+/m0/s1 |
| InChIKey | VEKFAAPACCFOKS-XYFQYJLHSA-N |
| XLogP | 5.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|