C23H19Br2NO4 — CID 139260049
ethyl 2-[(3R)-1-[bis(4-bromophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate (PubChem CID 139260049) has the molecular formula C23H19Br2NO4 and a molecular weight of 533.22 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-[bis(4-bromophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate.
| Compound Name | ethyl 2-[(3R)-1-[bis(4-bromophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
|---|---|
| PubChem CID | 139260049 |
| Molecular Formula | C23H19Br2NO4 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | ethyl 2-[(3R)-1-[bis(4-bromophenyl)methyl]-2,5-dioxopyrrolidin-3-yl]buta-2,3-dienoate |
| SMILES | C=C=C(C(=O)OCC)[C@H]1CC(=O)N(C(c2ccc(Br)cc2)c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C23H19Br2NO4/c1-3-18(23(29)30-4-2)19-13-20(27)26(22(19)28)21(14-5-9-16(24)10-6-14)15-7-11-17(25)12-8-15/h5-12,19,21H,1,4,13H2,2H3/t19-/m1/s1 |
| InChIKey | HBZPNBLZHWIMJV-LJQANCHMSA-N |
| XLogP | 4.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|