C19H17NO3S — CID 139260067
(3aS,9R,9aS)-2-benzyl-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione (PubChem CID 139260067) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is (3aS,9R,9aS)-2-benzyl-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione.
| Compound Name | (3aS,9R,9aS)-2-benzyl-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 139260067 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3aS,9R,9aS)-2-benzyl-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
| SMILES | Cc1ccc2c(c1)S[C@@H]1C(=O)N(Cc3ccccc3)C(=O)[C@@H]1[C@H]2O |
| InChI | InChI=1S/C19H17NO3S/c1-11-7-8-13-14(9-11)24-17-15(16(13)21)18(22)20(19(17)23)10-12-5-3-2-4-6-12/h2-9,15-17,21H,10H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | HWWNQGGTURJTGX-IKGGRYGDSA-N |
| XLogP | 2.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|