C20H19NO3S — CID 139260071
(3aS,9R,9aS)-2-(3,5-dimethylphenyl)-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione (PubChem CID 139260071) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is (3aS,9R,9aS)-2-(3,5-dimethylphenyl)-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione.
| Compound Name | (3aS,9R,9aS)-2-(3,5-dimethylphenyl)-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 139260071 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (3aS,9R,9aS)-2-(3,5-dimethylphenyl)-9-hydroxy-6-methyl-9,9a-dihydro-3aH-thiochromeno[2,3-c]pyrrole-1,3-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)[C@H]3[C@H](Sc4cc(C)ccc4[C@@H]3O)C2=O)c1 |
| InChI | InChI=1S/C20H19NO3S/c1-10-4-5-14-15(9-10)25-18-16(17(14)22)19(23)21(20(18)24)13-7-11(2)6-12(3)8-13/h4-9,16-18,22H,1-3H3/t16-,17+,18+/m1/s1 |
| InChIKey | KZWABOYEZIRFBG-SQNIBIBYSA-N |
| XLogP | 3.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|