C90H92Br2N6Zn — CID 139260814
zinc 2,18-bis(6-bromo-9-ethylcarbazol-3-yl)-5,10,15-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide (PubChem CID 139260814) has the molecular formula C90H92Br2N6Zn and a molecular weight of 1482.97 g/mol. Its IUPAC name is zinc 2,18-bis(6-bromo-9-ethylcarbazol-3-yl)-5,10,15-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide.
| Compound Name | zinc 2,18-bis(6-bromo-9-ethylcarbazol-3-yl)-5,10,15-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide |
|---|---|
| PubChem CID | 139260814 |
| Molecular Formula | C90H92Br2N6Zn |
| Molecular Weight | 1482.97 g/mol |
| Exact Mass | 1478.50 |
| IUPAC Name | zinc 2,18-bis(6-bromo-9-ethylcarbazol-3-yl)-5,10,15-tris(3,5-ditert-butylphenyl)porphyrin-22,24-diide |
| SMILES | CCn1c2ccc(Br)cc2c2cc(C3=Cc4nc3cc3[n-]c(cc3-c3ccc5c(c3)c3cc(Br)ccc3n5CC)c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)c3nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc([n-]5)c4-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)C=C3)ccc21.[Zn+2] |
| InChI | InChI=1S/C90H92Br2N6.Zn/c1-21-97-78-31-23-51(41-66(78)68-46-62(91)25-33-80(68)97)64-48-76-83(54-37-58(87(9,10)11)44-59(38-54)88(12,13)14)72-29-27-70(93-72)82(53-35-56(85(3,4)5)43-57(36-53)86(6,7)8)71-28-30-73(94-71)84(55-39-60(89(15,16)17)45-61(40-55)90(18,19)20)77-49-65(75(96-77)50-74(64)95-76)52-24-32-79-67(42-52)69-47-63(92)26-34-81(69)98(79)22-2;/h23-50H,21-22H2,1-20H3;/q-2;+2/b74-50-,75-50-,82-70-,82-71-,83-72-,83-76-,84-73-,84-77-; |
| InChIKey | VNOQPYDLEJFLRR-XRRFHXDOSA-N |
| XLogP | 25.56 |
| TPSA | 63.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 99 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1482.97 |
| LogP ≤ 5 | 25.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|