C28H22N4O2Se2 — CID 139262366
3-(4-methoxyphenyl)-1-[[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]diselanyl]imidazo[1,5-a]pyridine (PubChem CID 139262366) has the molecular formula C28H22N4O2Se2 and a molecular weight of 604.43 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-[[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]diselanyl]imidazo[1,5-a]pyridine.
| Compound Name | 3-(4-methoxyphenyl)-1-[[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]diselanyl]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 139262366 |
| Molecular Formula | C28H22N4O2Se2 |
| Molecular Weight | 604.43 g/mol |
| Exact Mass | 606.01 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-[[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]diselanyl]imidazo[1,5-a]pyridine |
| SMILES | COc1ccc(-c2nc([Se][Se]c3nc(-c4ccc(OC)cc4)n4ccccc34)c3ccccn23)cc1 |
| InChI | InChI=1S/C28H22N4O2Se2/c1-33-21-13-9-19(10-14-21)25-29-27(23-7-3-5-17-31(23)25)35-36-28-24-8-4-6-18-32(24)26(30-28)20-11-15-22(34-2)16-12-20/h3-18H,1-2H3 |
| InChIKey | HKKLIRVJNHESRB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|