C19H20N2OSi — CID 53469313
2-[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]ethynyl-trimethylsilane (PubChem CID 53469313) has the molecular formula C19H20N2OSi and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 53469313 |
| Molecular Formula | C19H20N2OSi |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)imidazo[1,5-a]pyridin-1-yl]ethynyl-trimethylsilane |
| SMILES | COc1ccc(-c2nc(C#C[Si](C)(C)C)c3ccccn23)cc1 |
| InChI | InChI=1S/C19H20N2OSi/c1-22-16-10-8-15(9-11-16)19-20-17(12-14-23(2,3)4)18-7-5-6-13-21(18)19/h5-11,13H,1-4H3 |
| InChIKey | RCIBIVGTUBTPNY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|