C21H18BrF3NO2P — CID 139263447
1-(4-bromophenyl)-N-diphenylphosphoryl-2,2,2-trifluoro-1-methoxyethanamine (PubChem CID 139263447) has the molecular formula C21H18BrF3NO2P and a molecular weight of 484.25 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-diphenylphosphoryl-2,2,2-trifluoro-1-methoxyethanamine.
| Compound Name | 1-(4-bromophenyl)-N-diphenylphosphoryl-2,2,2-trifluoro-1-methoxyethanamine |
|---|---|
| PubChem CID | 139263447 |
| Molecular Formula | C21H18BrF3NO2P |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 483.02 |
| IUPAC Name | 1-(4-bromophenyl)-N-diphenylphosphoryl-2,2,2-trifluoro-1-methoxyethanamine |
| SMILES | COC(NP(=O)(c1ccccc1)c1ccccc1)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H18BrF3NO2P/c1-28-20(21(23,24)25,16-12-14-17(22)15-13-16)26-29(27,18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15H,1H3,(H,26,27) |
| InChIKey | GNOIMIPVFRSUCZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|