C9H9BrF3NO — CID 58611142
1-(4-bromophenyl)-2,2,2-trifluoro-1-methoxyethanamine (PubChem CID 58611142) has the molecular formula C9H9BrF3NO and a molecular weight of 284.08 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,2,2-trifluoro-1-methoxyethanamine.
| Compound Name | 1-(4-bromophenyl)-2,2,2-trifluoro-1-methoxyethanamine |
|---|---|
| PubChem CID | 58611142 |
| Molecular Formula | C9H9BrF3NO |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 1-(4-bromophenyl)-2,2,2-trifluoro-1-methoxyethanamine |
| SMILES | COC(N)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H9BrF3NO/c1-15-8(14,9(11,12)13)6-2-4-7(10)5-3-6/h2-5H,14H2,1H3 |
| InChIKey | AMIGRZNCNHGQIB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|