C12H15BrFNO — CID 158538851
2-(4-bromo-2-fluorophenyl)-N-tert-butyloxiran-2-amine (PubChem CID 158538851) has the molecular formula C12H15BrFNO and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-N-tert-butyloxiran-2-amine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-N-tert-butyloxiran-2-amine |
|---|---|
| PubChem CID | 158538851 |
| Molecular Formula | C12H15BrFNO |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-N-tert-butyloxiran-2-amine |
| SMILES | CC(C)(C)NC1(c2ccc(Br)cc2F)CO1 |
| InChI | InChI=1S/C12H15BrFNO/c1-11(2,3)15-12(7-16-12)9-5-4-8(13)6-10(9)14/h4-6,15H,7H2,1-3H3 |
| InChIKey | HOGTZOVHRAYMFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|