C8H7BrF3NO — CID 123569590
1-amino-1-(4-bromophenyl)-2,2,2-trifluoroethanol (PubChem CID 123569590) has the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. Its IUPAC name is 1-amino-1-(4-bromophenyl)-2,2,2-trifluoroethanol.
| Compound Name | 1-amino-1-(4-bromophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 123569590 |
| Molecular Formula | C8H7BrF3NO |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 1-amino-1-(4-bromophenyl)-2,2,2-trifluoroethanol |
| SMILES | NC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H7BrF3NO/c9-6-3-1-5(2-4-6)7(13,14)8(10,11)12/h1-4,14H,13H2 |
| InChIKey | NXJOJCQQBBGKBS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|