C9H7BrF3N3O — CID 102044510
(2R)-3-azido-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 102044510) has the molecular formula C9H7BrF3N3O and a molecular weight of 310.07 g/mol. Its IUPAC name is (2R)-3-azido-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-3-azido-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 102044510 |
| Molecular Formula | C9H7BrF3N3O |
| Molecular Weight | 310.07 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | (2R)-3-azido-2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | [N-]=[N+]=NC[C@](O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H7BrF3N3O/c10-7-3-1-6(2-4-7)8(17,5-15-16-14)9(11,12)13/h1-4,17H,5H2/t8-/m0/s1 |
| InChIKey | RDRKNFVQEGGQHN-QMMMGPOBSA-N |
| XLogP | 3.51 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|