C14H20BrF2NO — CID 87794943
1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol (PubChem CID 87794943) has the molecular formula C14H20BrF2NO and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol.
| Compound Name | 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 87794943 |
| Molecular Formula | C14H20BrF2NO |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)CCC(O)(NCC(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrF2NO/c1-10(2)7-8-14(19,18-9-13(16)17)11-3-5-12(15)6-4-11/h3-6,10,13,18-19H,7-9H2,1-2H3 |
| InChIKey | BTRLSGSYRVBGOG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|