About 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol
1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol (PubChem CID 87794943) has the molecular formula C14H20BrF2NO
and a molecular weight of 336.22 g/mol. Its IUPAC name is 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
| PubChem CID | 87794943 |
| Molecular Formula | C14H20BrF2NO |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)CCC(O)(NCC(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrF2NO/c1-10(2)7-8-14(19,18-9-13(16)17)11-3-5-12(15)6-4-11/h3-6,10,13,18-19H,7-9H2,1-2H3 |
| InChIKey | BTRLSGSYRVBGOG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol?
The IUPAC name of 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol (CID 87794943) is 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol.
What is the SMILES notation for 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol?
The canonical SMILES for 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol is CC(C)CCC(O)(NCC(F)F)c1ccc(Br)cc1.
What is the InChIKey of 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol?
The InChIKey is BTRLSGSYRVBGOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrF2NO/c1-10(2)7-8-14(19,18-9-13(16)17)11-3-5-12(15)6-4-11/h3-6,10,13,18-19H,7-9H2,1-2H3.
What are the key properties of 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol?
1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol has a molecular weight of 336.22 g/mol, XLogP of 3.89, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-1-(2,2-difluoroethylamino)-4-methylpentan-1-ol is sourced from PubChem (CID 87794943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).