About 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol
1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol (PubChem CID 91016892) has the molecular formula C8H6Br2F2O
and a molecular weight of 315.94 g/mol. Its IUPAC name is 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol |
| PubChem CID | 91016892 |
| Molecular Formula | C8H6Br2F2O |
| Molecular Weight | 315.94 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol |
| SMILES | OC(Br)(c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C8H6Br2F2O/c9-6-3-1-5(2-4-6)8(10,13)7(11)12/h1-4,7,13H |
| InChIKey | MHASPNJAIQTSRF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.94 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol?
The IUPAC name of 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol (CID 91016892) is 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol.
What is the SMILES notation for 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol?
The canonical SMILES for 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol is OC(Br)(c1ccc(Br)cc1)C(F)F.
What is the InChIKey of 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol?
The InChIKey is MHASPNJAIQTSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2F2O/c9-6-3-1-5(2-4-6)8(10,13)7(11)12/h1-4,7,13H.
What are the key properties of 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol?
1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol has a molecular weight of 315.94 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-1-(4-bromophenyl)-2,2-difluoroethanol is sourced from PubChem (CID 91016892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).