C29H37NO6Se — CID 139265815
methyl 2-[(1R,5R,7R,8aS)-7-hydroxy-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-8-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate (PubChem CID 139265815) has the molecular formula C29H37NO6Se and a molecular weight of 574.58 g/mol. Its IUPAC name is methyl 2-[(1R,5R,7R,8aS)-7-hydroxy-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-8-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate.
| Compound Name | methyl 2-[(1R,5R,7R,8aS)-7-hydroxy-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-8-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate |
|---|---|
| PubChem CID | 139265815 |
| Molecular Formula | C29H37NO6Se |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | methyl 2-[(1R,5R,7R,8aS)-7-hydroxy-3-oxo-1-[(1S)-1-phenylmethoxyhexyl]-8-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]acetate |
| SMILES | CCCCC[C@H](OCc1ccccc1)[C@@H]1OC(=O)N2[C@@H](CC(=O)OC)C[C@@H](O)C([Se]c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C29H37NO6Se/c1-3-4-7-16-24(35-19-20-12-8-5-9-13-20)27-26-28(37-22-14-10-6-11-15-22)23(31)17-21(18-25(32)34-2)30(26)29(33)36-27/h5-6,8-15,21,23-24,26-28,31H,3-4,7,16-19H2,1-2H3/t21-,23-,24+,26+,27+,28?/m1/s1 |
| InChIKey | ACNNEUHZEGYBAN-KYRWKBJJSA-N |
| XLogP | 3.86 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|