About bis(N-methylmethanamine);(phenylditellanyl)benzene
bis(N-methylmethanamine);(phenylditellanyl)benzene (PubChem CID 139266272) has the molecular formula C16H24N2Te2
and a molecular weight of 499.58 g/mol. Its IUPAC name is bis(N-methylmethanamine);(phenylditellanyl)benzene.
Molecular Properties
| Compound Name | bis(N-methylmethanamine);(phenylditellanyl)benzene |
| PubChem CID | 139266272 |
| Molecular Formula | C16H24N2Te2 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | bis(N-methylmethanamine);(phenylditellanyl)benzene |
| SMILES | CNC.CNC.c1ccc([Te][Te]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Te2.2C2H7N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;2*1-3-2/h1-10H;2*3H,1-2H3 |
| InChIKey | MOCRJCIBHJLOLW-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(N-methylmethanamine);(phenylditellanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-methylmethanamine);(phenylditellanyl)benzene?
The IUPAC name of bis(N-methylmethanamine);(phenylditellanyl)benzene (CID 139266272) is bis(N-methylmethanamine);(phenylditellanyl)benzene.
What is the SMILES notation for bis(N-methylmethanamine);(phenylditellanyl)benzene?
The canonical SMILES for bis(N-methylmethanamine);(phenylditellanyl)benzene is CNC.CNC.c1ccc([Te][Te]c2ccccc2)cc1.
What is the InChIKey of bis(N-methylmethanamine);(phenylditellanyl)benzene?
The InChIKey is MOCRJCIBHJLOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Te2.2C2H7N/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;2*1-3-2/h1-10H;2*3H,1-2H3.
What are the key properties of bis(N-methylmethanamine);(phenylditellanyl)benzene?
bis(N-methylmethanamine);(phenylditellanyl)benzene has a molecular weight of 499.58 g/mol, XLogP of 0.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-methylmethanamine);(phenylditellanyl)benzene is sourced from PubChem (CID 139266272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).