About benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium
benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium (PubChem CID 139058006) has the molecular formula C18H28N2Se2
and a molecular weight of 430.36 g/mol. Its IUPAC name is benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium.
Molecular Properties
| Compound Name | benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium |
| PubChem CID | 139058006 |
| Molecular Formula | C18H28N2Se2 |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC[NH+](C)C.[Se-]c1ccccc1.[Se-]c1ccccc1 |
| InChI | InChI=1S/C6H16N2.2C6H6Se/c1-7(2)5-6-8(3)4;2*7-6-4-2-1-3-5-6/h5-6H2,1-4H3;2*1-5,7H |
| InChIKey | UPIQZLMVMSYVPQ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The IUPAC name of benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium (CID 139058006) is benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium.
What is the SMILES notation for benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The canonical SMILES for benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium is C[NH+](C)CC[NH+](C)C.[Se-]c1ccccc1.[Se-]c1ccccc1.
What is the InChIKey of benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium?
The InChIKey is UPIQZLMVMSYVPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.2C6H6Se/c1-7(2)5-6-8(3)4;2*7-6-4-2-1-3-5-6/h5-6H2,1-4H3;2*1-5,7H.
What are the key properties of benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium?
benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium has a molecular weight of 430.36 g/mol, XLogP of -1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzeneselenolate;2-(dimethylazaniumyl)ethyl-dimethylazanium is sourced from PubChem (CID 139058006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).