C18H26CdN2Se2 — CID 139129590
benzeneselenolate;cadmium(2+);N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 139129590) has the molecular formula C18H26CdN2Se2 and a molecular weight of 540.75 g/mol. Its IUPAC name is benzeneselenolate;cadmium(2+);N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | benzeneselenolate;cadmium(2+);N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 139129590 |
| Molecular Formula | C18H26CdN2Se2 |
| Molecular Weight | 540.75 g/mol |
| Exact Mass | 543.95 |
| IUPAC Name | benzeneselenolate;cadmium(2+);N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C.[Cd+2].[Se-]c1ccccc1.[Se-]c1ccccc1 |
| InChI | InChI=1S/C6H16N2.2C6H6Se.Cd/c1-7(2)5-6-8(3)4;2*7-6-4-2-1-3-5-6;/h5-6H2,1-4H3;2*1-5,7H;/q;;;+2/p-2 |
| InChIKey | RGNYDARSGCZIOM-UHFFFAOYSA-L |
| XLogP | 1.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.75 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|