C21H31N2P — CID 134926205
N-(1-diphenylphosphanylpropan-2-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 134926205) has the molecular formula C21H31N2P and a molecular weight of 342.47 g/mol. Its IUPAC name is N-(1-diphenylphosphanylpropan-2-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(1-diphenylphosphanylpropan-2-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 134926205 |
| Molecular Formula | C21H31N2P |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | N-(1-diphenylphosphanylpropan-2-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNC(C)CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H31N2P/c1-4-23(5-2)17-16-22-19(3)18-24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22H,4-5,16-18H2,1-3H3 |
| InChIKey | IDHWBOFRDJLVHD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|