C22H32O4 — CID 139266805
[6-oxo-2-[(E)-prop-1-enyl]-2,3-dihydropyran-3-yl] (2E,4E)-4,6-dimethyldodeca-2,4-dienoate (PubChem CID 139266805) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [6-oxo-2-[(E)-prop-1-enyl]-2,3-dihydropyran-3-yl] (2E,4E)-4,6-dimethyldodeca-2,4-dienoate.
| Compound Name | [6-oxo-2-[(E)-prop-1-enyl]-2,3-dihydropyran-3-yl] (2E,4E)-4,6-dimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 139266805 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [6-oxo-2-[(E)-prop-1-enyl]-2,3-dihydropyran-3-yl] (2E,4E)-4,6-dimethyldodeca-2,4-dienoate |
| SMILES | C/C=C/C1OC(=O)C=CC1OC(=O)/C=C/C(C)=C/C(C)CCCCCC |
| InChI | InChI=1S/C22H32O4/c1-5-7-8-9-11-17(3)16-18(4)12-14-21(23)26-20-13-15-22(24)25-19(20)10-6-2/h6,10,12-17,19-20H,5,7-9,11H2,1-4H3/b10-6+,14-12+,18-16+ |
| InChIKey | CQTZIHSZGZYODO-VJBRUVFXSA-N |
| XLogP | 5.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|