C12H16INO3S — CID 139267010
2-iodo-1-phenoxycyclohexane-1-sulfonamide (PubChem CID 139267010) has the molecular formula C12H16INO3S and a molecular weight of 381.24 g/mol. Its IUPAC name is 2-iodo-1-phenoxycyclohexane-1-sulfonamide.
| Compound Name | 2-iodo-1-phenoxycyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 139267010 |
| Molecular Formula | C12H16INO3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 2-iodo-1-phenoxycyclohexane-1-sulfonamide |
| SMILES | NS(=O)(=O)C1(Oc2ccccc2)CCCCC1I |
| InChI | InChI=1S/C12H16INO3S/c13-11-8-4-5-9-12(11,18(14,15)16)17-10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2,(H2,14,15,16) |
| InChIKey | CIQFDZLNJLKAMS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|