C15H20N4O2 — CID 139267119
1-amino-5-propan-2-yl-6,7,8,9-tetrahydrofuro[2,3-c]isoquinoline-2-carbohydrazide (PubChem CID 139267119) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-amino-5-propan-2-yl-6,7,8,9-tetrahydrofuro[2,3-c]isoquinoline-2-carbohydrazide.
| Compound Name | 1-amino-5-propan-2-yl-6,7,8,9-tetrahydrofuro[2,3-c]isoquinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 139267119 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-amino-5-propan-2-yl-6,7,8,9-tetrahydrofuro[2,3-c]isoquinoline-2-carbohydrazide |
| SMILES | CC(C)c1nc2oc(C(=O)NN)c(N)c2c2c1CCCC2 |
| InChI | InChI=1S/C15H20N4O2/c1-7(2)12-9-6-4-3-5-8(9)10-11(16)13(14(20)19-17)21-15(10)18-12/h7H,3-6,16-17H2,1-2H3,(H,19,20) |
| InChIKey | TUFPSBRLLBUTFC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|