C16H16ClN5 — CID 139267158
3-(4-chloroanilino)-1-hydrazinyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile (PubChem CID 139267158) has the molecular formula C16H16ClN5 and a molecular weight of 313.79 g/mol. Its IUPAC name is 3-(4-chloroanilino)-1-hydrazinyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile.
| Compound Name | 3-(4-chloroanilino)-1-hydrazinyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 139267158 |
| Molecular Formula | C16H16ClN5 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(4-chloroanilino)-1-hydrazinyl-5,6,7,8-tetrahydroisoquinoline-4-carbonitrile |
| SMILES | N#Cc1c(Nc2ccc(Cl)cc2)nc(NN)c2c1CCCC2 |
| InChI | InChI=1S/C16H16ClN5/c17-10-5-7-11(8-6-10)20-15-14(9-18)12-3-1-2-4-13(12)16(21-15)22-19/h5-8H,1-4,19H2,(H2,20,21,22) |
| InChIKey | SVHPPYROEJRMFH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|