C14H14N6 — CID 94672708
4-[(4-hydrazinyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]benzonitrile (PubChem CID 94672708) has the molecular formula C14H14N6 and a molecular weight of 266.31 g/mol. Its IUPAC name is 4-[(4-hydrazinyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]benzonitrile.
| Compound Name | 4-[(4-hydrazinyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 94672708 |
| Molecular Formula | C14H14N6 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-[(4-hydrazinyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc3c(c(NN)n2)CCC3)cc1 |
| InChI | InChI=1S/C14H14N6/c15-8-9-4-6-10(7-5-9)17-14-18-12-3-1-2-11(12)13(19-14)20-16/h4-7H,1-3,16H2,(H2,17,18,19,20) |
| InChIKey | JRWSUVNPAHSWCB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|