C14H16N4 — CID 62250852
[2-(2-methylphenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 62250852) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is [2-(2-methylphenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2-methylphenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62250852 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [2-(2-methylphenyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1ccccc1-c1nc2c(c(NN)n1)CCC2 |
| InChI | InChI=1S/C14H16N4/c1-9-5-2-3-6-10(9)13-16-12-8-4-7-11(12)14(17-13)18-15/h2-3,5-6H,4,7-8,15H2,1H3,(H,16,17,18) |
| InChIKey | AEJIEIJRZMCCKS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|