C15H18N4 — CID 62252758
[2-(2-methylphenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine (PubChem CID 62252758) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is [2-(2-methylphenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine.
| Compound Name | [2-(2-methylphenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 62252758 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [2-(2-methylphenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]hydrazine |
| SMILES | Cc1ccccc1-c1nc2c(c(NN)n1)CCCC2 |
| InChI | InChI=1S/C15H18N4/c1-10-6-2-3-7-11(10)14-17-13-9-5-4-8-12(13)15(18-14)19-16/h2-3,6-7H,4-5,8-9,16H2,1H3,(H,17,18,19) |
| InChIKey | KVTMAKANMLWZIR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|