C11H13N5S — CID 104771595
[2-(4-methyl-1,3-thiazol-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 104771595) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is [2-(4-methyl-1,3-thiazol-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-methyl-1,3-thiazol-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 104771595 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | [2-(4-methyl-1,3-thiazol-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1csc(-c2nc3c(c(NN)n2)CCC3)n1 |
| InChI | InChI=1S/C11H13N5S/c1-6-5-17-11(13-6)10-14-8-4-2-3-7(8)9(15-10)16-12/h5H,2-4,12H2,1H3,(H,14,15,16) |
| InChIKey | DNRKLUGDOALFGG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|