C11H11ClN4S — CID 79427224
[2-(4-chlorothiophen-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 79427224) has the molecular formula C11H11ClN4S and a molecular weight of 266.76 g/mol. Its IUPAC name is [2-(4-chlorothiophen-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(4-chlorothiophen-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79427224 |
| Molecular Formula | C11H11ClN4S |
| Molecular Weight | 266.76 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | [2-(4-chlorothiophen-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2cc(Cl)cs2)nc2c1CCC2 |
| InChI | InChI=1S/C11H11ClN4S/c12-6-4-9(17-5-6)11-14-8-3-1-2-7(8)10(15-11)16-13/h4-5H,1-3,13H2,(H,14,15,16) |
| InChIKey | DUCOQYCDHKANJX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.76 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|