C29H19N9S — CID 139267639
1-phenyl-3-[2-(22-thia-17,19,24,25-tetrazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(25),2(7),3,5,8,10,12,14,16,18,20,23-dodecaen-3-yl)hydrazinyl]pyrazol-5-amine (PubChem CID 139267639) has the molecular formula C29H19N9S and a molecular weight of 525.60 g/mol. Its IUPAC name is 1-phenyl-3-[2-(22-thia-17,19,24,25-tetrazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(25),2(7),3,5,8,10,12,14,16,18,20,23-dodecaen-3-yl)hydrazinyl]pyrazol-5-amine.
| Compound Name | 1-phenyl-3-[2-(22-thia-17,19,24,25-tetrazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(25),2(7),3,5,8,10,12,14,16,18,20,23-dodecaen-3-yl)hydrazinyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 139267639 |
| Molecular Formula | C29H19N9S |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1-phenyl-3-[2-(22-thia-17,19,24,25-tetrazahexacyclo[12.11.0.02,7.08,13.015,23.016,21]pentacosa-1(25),2(7),3,5,8,10,12,14,16,18,20,23-dodecaen-3-yl)hydrazinyl]pyrazol-5-amine |
| SMILES | Nc1cc(NNc2cccc3c4ccccc4c4c(nnc5sc6cncnc6c54)c23)nn1-c1ccccc1 |
| InChI | InChI=1S/C29H19N9S/c30-22-13-23(37-38(22)16-7-2-1-3-8-16)34-33-20-12-6-11-18-17-9-4-5-10-19(17)25-26-27-21(14-31-15-32-27)39-29(26)36-35-28(25)24(18)20/h1-15,33H,30H2,(H,34,37) |
| InChIKey | CQRMDIFUGHBFKD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|