C32H26ClF2N3O4 — CID 139268732
methyl N-[(11R,13R,15S)-15-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-9-oxo-8-azatetracyclo[14.3.1.02,7.011,13]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate (PubChem CID 139268732) has the molecular formula C32H26ClF2N3O4 and a molecular weight of 590.03 g/mol. Its IUPAC name is methyl N-[(11R,13R,15S)-15-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-9-oxo-8-azatetracyclo[14.3.1.02,7.011,13]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[(11R,13R,15S)-15-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-9-oxo-8-azatetracyclo[14.3.1.02,7.011,13]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 139268732 |
| Molecular Formula | C32H26ClF2N3O4 |
| Molecular Weight | 590.03 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | methyl N-[(11R,13R,15S)-15-[5-(3-chloro-2,6-difluorophenyl)-1-oxidopyridin-1-ium-2-yl]-9-oxo-8-azatetracyclo[14.3.1.02,7.011,13]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C[C@H]1C[C@@H]1C[C@H](c1ccc(-c3c(F)ccc(Cl)c3F)c[n+]1[O-])c1cccc-2c1 |
| InChI | InChI=1S/C32H26ClF2N3O4/c1-42-32(40)36-22-6-7-23-17-3-2-4-18(11-17)24(13-20-12-21(20)14-29(39)37-27(23)15-22)28-10-5-19(16-38(28)41)30-26(34)9-8-25(33)31(30)35/h2-11,15-16,20-21,24H,12-14H2,1H3,(H,36,40)(H,37,39)/t20-,21-,24+/m1/s1 |
| InChIKey | QJNZWQVLVDJCSX-LGVFNWMJSA-N |
| XLogP | 7.26 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.03 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|