C34H30ClF3N2O5 — CID 157447412
methyl 2-[(10S,14S)-14-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-oxidopyridin-1-ium-2-yl]-10-methyl-9-oxo-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate (PubChem CID 157447412) has the molecular formula C34H30ClF3N2O5 and a molecular weight of 639.07 g/mol. Its IUPAC name is methyl 2-[(10S,14S)-14-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-oxidopyridin-1-ium-2-yl]-10-methyl-9-oxo-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate.
| Compound Name | methyl 2-[(10S,14S)-14-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-oxidopyridin-1-ium-2-yl]-10-methyl-9-oxo-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate |
|---|---|
| PubChem CID | 157447412 |
| Molecular Formula | C34H30ClF3N2O5 |
| Molecular Weight | 639.07 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | methyl 2-[(10S,14S)-14-[5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-oxidopyridin-1-ium-2-yl]-10-methyl-9-oxo-8-azatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)NC(=O)[C@@H](C)CCC[C@H](c1ccc(-c3cc(Cl)ccc3OC(F)(F)F)c[n+]1[O-])c1cccc-2c1 |
| InChI | InChI=1S/C34H30ClF3N2O5/c1-20-5-3-8-27(30-13-10-24(19-40(30)43)28-18-25(35)11-14-31(28)45-34(36,37)38)23-7-4-6-22(17-23)26-12-9-21(16-32(41)44-2)15-29(26)39-33(20)42/h4,6-7,9-15,17-20,27H,3,5,8,16H2,1-2H3,(H,39,42)/t20-,27-/m0/s1 |
| InChIKey | BSJUCKHVFHAALD-DCFHFQCYSA-N |
| XLogP | 7.81 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.07 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|